C22H20ClN5O2S — CID 164809124
N-[2-chloro-5-[4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]-3-pyridinyl]methanesulfonamide (PubChem CID 164809124) has the molecular formula C22H20ClN5O2S and a molecular weight of 453.96 g/mol. Its IUPAC name is N-[2-chloro-5-[4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 164809124 |
| Molecular Formula | C22H20ClN5O2S |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-[2-chloro-5-[4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]-3-pyridinyl]methanesulfonamide |
| SMILES | C[C@@H](Nc1ncnc2ccc(-c3cnc(Cl)c(NS(C)(=O)=O)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C22H20ClN5O2S/c1-14(15-6-4-3-5-7-15)27-22-18-10-16(8-9-19(18)25-13-26-22)17-11-20(21(23)24-12-17)28-31(2,29)30/h3-14,28H,1-2H3,(H,25,26,27)/t14-/m1/s1 |
| InChIKey | LPJIZDSOUGHTNB-CQSZACIVSA-N |
| XLogP | 4.89 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|