C39H46ClN3O3 — CID 164809358
5-[(4-tert-butyl-2-chlorophenyl)-[6-(3,5-ditert-butylphenyl)-1H-indol-3-yl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 164809358) has the molecular formula C39H46ClN3O3 and a molecular weight of 640.27 g/mol. Its IUPAC name is 5-[(4-tert-butyl-2-chlorophenyl)-[6-(3,5-ditert-butylphenyl)-1H-indol-3-yl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-tert-butyl-2-chlorophenyl)-[6-(3,5-ditert-butylphenyl)-1H-indol-3-yl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 164809358 |
| Molecular Formula | C39H46ClN3O3 |
| Molecular Weight | 640.27 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | 5-[(4-tert-butyl-2-chlorophenyl)-[6-(3,5-ditert-butylphenyl)-1H-indol-3-yl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(C(c2ccc(C(C)(C)C)cc2Cl)c2c[nH]c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)ccc23)C(=O)N(C)C1=O |
| InChI | InChI=1S/C39H46ClN3O3/c1-37(2,3)24-13-15-28(30(40)20-24)32(33-34(44)42(10)36(46)43(11)35(33)45)29-21-41-31-18-22(12-14-27(29)31)23-16-25(38(4,5)6)19-26(17-23)39(7,8)9/h12-21,32-33,41H,1-11H3 |
| InChIKey | RZWJIDARTFSNJQ-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.27 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|