C15H12N4O — CID 164809828
3,10,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,4,6,8,11(15),13,16-heptaene-5-carboxamide (PubChem CID 164809828) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 3,10,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,4,6,8,11(15),13,16-heptaene-5-carboxamide.
| Compound Name | 3,10,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,4,6,8,11(15),13,16-heptaene-5-carboxamide |
|---|---|
| PubChem CID | 164809828 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3,10,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,4,6,8,11(15),13,16-heptaene-5-carboxamide |
| SMILES | NC(=O)C1=CN2C=C3N=CC4=C(CC=C4)N3C=C2C=C1 |
| InChI | InChI=1S/C15H12N4O/c16-15(20)11-4-5-12-8-19-13-3-1-2-10(13)6-17-14(19)9-18(12)7-11/h1-2,4-9H,3H2,(H2,16,20) |
| InChIKey | AQYDPSNEEIIBKG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |