C7H22P6 — CID 164810270
[1-[2,2-bis(phosphanyl)propyl]-1,3,3-tris(phosphanyl)butyl]phosphane (PubChem CID 164810270) has the molecular formula C7H22P6 and a molecular weight of 292.10 g/mol. Its IUPAC name is [1-[2,2-bis(phosphanyl)propyl]-1,3,3-tris(phosphanyl)butyl]phosphane.
| Compound Name | [1-[2,2-bis(phosphanyl)propyl]-1,3,3-tris(phosphanyl)butyl]phosphane |
|---|---|
| PubChem CID | 164810270 |
| Molecular Formula | C7H22P6 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | [1-[2,2-bis(phosphanyl)propyl]-1,3,3-tris(phosphanyl)butyl]phosphane |
| SMILES | CC(P)(P)CC(P)(P)CC(C)(P)P |
| InChI | InChI=1S/C7H22P6/c1-5(8,9)3-7(12,13)4-6(2,10)11/h3-4,8-13H2,1-2H3 |
| InChIKey | AJYJTMUOFCUVTR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|