C11H10ClF3N2O — CID 164810416
4-chloro-6-methyl-2-(1,1,1-trifluoropropan-2-yl)-1H-pyrrolo[3,4-c]pyridin-3-one (PubChem CID 164810416) has the molecular formula C11H10ClF3N2O and a molecular weight of 278.66 g/mol. Its IUPAC name is 4-chloro-6-methyl-2-(1,1,1-trifluoropropan-2-yl)-1H-pyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 4-chloro-6-methyl-2-(1,1,1-trifluoropropan-2-yl)-1H-pyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 164810416 |
| Molecular Formula | C11H10ClF3N2O |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-chloro-6-methyl-2-(1,1,1-trifluoropropan-2-yl)-1H-pyrrolo[3,4-c]pyridin-3-one |
| SMILES | Cc1cc2c(c(Cl)n1)C(=O)N(C(C)C(F)(F)F)C2 |
| InChI | InChI=1S/C11H10ClF3N2O/c1-5-3-7-4-17(6(2)11(13,14)15)10(18)8(7)9(12)16-5/h3,6H,4H2,1-2H3 |
| InChIKey | YHCJVMWYGYFKDA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|