C38H64Si — CID 164810430
[4-(3,5-ditert-butylcyclohexyl)-2-methyl-1,3a,4,4a,5,6,7,7a,8,8a-decahydro-s-indacen-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 164810430) has the molecular formula C38H64Si and a molecular weight of 549.02 g/mol. Its IUPAC name is [4-(3,5-ditert-butylcyclohexyl)-2-methyl-1,3a,4,4a,5,6,7,7a,8,8a-decahydro-s-indacen-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | [4-(3,5-ditert-butylcyclohexyl)-2-methyl-1,3a,4,4a,5,6,7,7a,8,8a-decahydro-s-indacen-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 164810430 |
| Molecular Formula | C38H64Si |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.48 |
| IUPAC Name | [4-(3,5-ditert-butylcyclohexyl)-2-methyl-1,3a,4,4a,5,6,7,7a,8,8a-decahydro-s-indacen-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC2C(CC3CCCC3C2C2CC(C(C)(C)C)CC(C(C)(C)C)C2)C1[Si](C)(C)C1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C38H64Si/c1-22-17-32-33(35(22)39(12,13)36-25(4)23(2)24(3)26(36)5)20-27-15-14-16-31(27)34(32)28-18-29(37(6,7)8)21-30(19-28)38(9,10)11/h17,27-36H,14-16,18-21H2,1-13H3 |
| InChIKey | DUBKYZGBRDMFAL-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|