C45H39BF2N2O2 — CID 164810449
[4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-3,5-dimethylphenyl] 4-perylen-3-ylbutanoate (PubChem CID 164810449) has the molecular formula C45H39BF2N2O2 and a molecular weight of 688.63 g/mol. Its IUPAC name is [4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-3,5-dimethylphenyl] 4-perylen-3-ylbutanoate.
| Compound Name | [4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-3,5-dimethylphenyl] 4-perylen-3-ylbutanoate |
|---|---|
| PubChem CID | 164810449 |
| Molecular Formula | C45H39BF2N2O2 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | [4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-3,5-dimethylphenyl] 4-perylen-3-ylbutanoate |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1c(C)cc(OC(=O)CCCc3ccc4c5cccc6cccc(c7cccc3c74)c65)cc1C)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C45H39BF2N2O2/c1-25-23-33(24-26(2)40(25)43-44-27(3)21-29(5)49(44)46(47,48)50-30(6)22-28(4)45(43)50)52-39(51)18-9-11-31-19-20-38-36-16-8-13-32-12-7-15-35(41(32)36)37-17-10-14-34(31)42(37)38/h7-8,10,12-17,19-24H,9,11,18H2,1-6H3 |
| InChIKey | IRHDOGINHYBTBC-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|