C38H33BF2N2O2 — CID 164810474
perylen-3-ylmethyl 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)butanoate (PubChem CID 164810474) has the molecular formula C38H33BF2N2O2 and a molecular weight of 598.50 g/mol. Its IUPAC name is perylen-3-ylmethyl 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)butanoate.
| Compound Name | perylen-3-ylmethyl 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)butanoate |
|---|---|
| PubChem CID | 164810474 |
| Molecular Formula | C38H33BF2N2O2 |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | perylen-3-ylmethyl 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)butanoate |
| SMILES | CC1=CC(C)=[N+]2C1=C(CCCC(=O)OCc1ccc3c4cccc5cccc(c6cccc1c63)c54)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C38H33BF2N2O2/c1-22-19-24(3)42-37(22)33(38-23(2)20-25(4)43(38)39(42,40)41)15-8-16-34(44)45-21-27-17-18-32-30-13-6-10-26-9-5-12-29(35(26)30)31-14-7-11-28(27)36(31)32/h5-7,9-14,17-20H,8,15-16,21H2,1-4H3 |
| InChIKey | SILPUTKMWRFRKA-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|