C17H33N2+ — CID 164811406
1-(9-ethyl-4,4-dimethyl-4-azoniatricyclo[5.2.2.02,6]undecan-8-yl)-N,N-dimethylmethanamine (PubChem CID 164811406) has the molecular formula C17H33N2+ and a molecular weight of 265.46 g/mol. Its IUPAC name is 1-(9-ethyl-4,4-dimethyl-4-azoniatricyclo[5.2.2.02,6]undecan-8-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(9-ethyl-4,4-dimethyl-4-azoniatricyclo[5.2.2.02,6]undecan-8-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 164811406 |
| Molecular Formula | C17H33N2+ |
| Molecular Weight | 265.46 g/mol |
| Exact Mass | 265.26 |
| IUPAC Name | 1-(9-ethyl-4,4-dimethyl-4-azoniatricyclo[5.2.2.02,6]undecan-8-yl)-N,N-dimethylmethanamine |
| SMILES | CCC1C2CCC(C1CN(C)C)C1C[N+](C)(C)CC21 |
| InChI | InChI=1S/C17H33N2/c1-6-12-13-7-8-14(15(12)9-18(2)3)17-11-19(4,5)10-16(13)17/h12-17H,6-11H2,1-5H3/q+1 |
| InChIKey | YMJUVQIMOCVZEF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|