C40H28N4O4 — CID 164811877
7,18-bis(3-phenylpropyl)-7,11,18,22-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone (PubChem CID 164811877) has the molecular formula C40H28N4O4 and a molecular weight of 628.69 g/mol. Its IUPAC name is 7,18-bis(3-phenylpropyl)-7,11,18,22-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7,18-bis(3-phenylpropyl)-7,11,18,22-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 164811877 |
| Molecular Formula | C40H28N4O4 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 7,18-bis(3-phenylpropyl)-7,11,18,22-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
| SMILES | O=C1c2ccc3c4ncc5c6c(ccc(c7ncc(c2c37)C(=O)N1CCCc1ccccc1)c64)C(=O)N(CCCc1ccccc1)C5=O |
| InChI | InChI=1S/C40H28N4O4/c45-37-27-17-15-25-33-31(27)29(39(47)43(37)19-7-13-23-9-3-1-4-10-23)21-41-35(33)26-16-18-28-32-30(22-42-36(25)34(26)32)40(48)44(38(28)46)20-8-14-24-11-5-2-6-12-24/h1-6,9-12,15-18,21-22H,7-8,13-14,19-20H2 |
| InChIKey | LIMIGXGVIFIZSC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|