C14H10FN3O3 — CID 164812013
[2-(2-fluorophenyl)-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl formate (PubChem CID 164812013) has the molecular formula C14H10FN3O3 and a molecular weight of 287.25 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl formate.
| Compound Name | [2-(2-fluorophenyl)-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl formate |
|---|---|
| PubChem CID | 164812013 |
| Molecular Formula | C14H10FN3O3 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | [2-(2-fluorophenyl)-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl formate |
| SMILES | O=COCc1cc2c(=O)[nH]c(-c3ccccc3F)nn2c1 |
| InChI | InChI=1S/C14H10FN3O3/c15-11-4-2-1-3-10(11)13-16-14(20)12-5-9(7-21-8-19)6-18(12)17-13/h1-6,8H,7H2,(H,16,17,20) |
| InChIKey | UQCHGJDWEKBZOE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|