About N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide
N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide (PubChem CID 164812943) has the molecular formula C7H16N2S2
and a molecular weight of 192.35 g/mol. Its IUPAC name is N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide.
Molecular Properties
| Compound Name | N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide |
| PubChem CID | 164812943 |
| Molecular Formula | C7H16N2S2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide |
| SMILES | C/C(=N/CS)N(CS)C(C)C |
| InChI | InChI=1S/C7H16N2S2/c1-6(2)9(5-11)7(3)8-4-10/h6,10-11H,4-5H2,1-3H3/b8-7- |
| InChIKey | HLOXYVAGQBEVAH-FPLPWBNLSA-N |
| XLogP | 1.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide?
The IUPAC name of N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide (CID 164812943) is N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide.
What is the SMILES notation for N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide?
The canonical SMILES for N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide is C/C(=N/CS)N(CS)C(C)C.
What is the InChIKey of N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide?
The InChIKey is HLOXYVAGQBEVAH-FPLPWBNLSA-N. The full InChI is InChI=1S/C7H16N2S2/c1-6(2)9(5-11)7(3)8-4-10/h6,10-11H,4-5H2,1-3H3/b8-7-.
What are the key properties of N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide?
N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide has a molecular weight of 192.35 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-N,N'-bis(sulfanylmethyl)ethanimidamide is sourced from PubChem (CID 164812943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).