C35H20F6N4O5 — CID 164812962
5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 164812962) has the molecular formula C35H20F6N4O5 and a molecular weight of 690.56 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 164812962 |
| Molecular Formula | C35H20F6N4O5 |
| Molecular Weight | 690.56 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(N4C(=O)c5ccc(C(c6ccc7c(c6)C(=O)N(C)C7=O)(C(F)(F)F)C(F)(F)F)cc5C4=O)cc3)o2)cc1 |
| InChI | InChI=1S/C35H20F6N4O5/c1-17-3-5-18(6-4-17)27-42-43-28(50-27)19-7-11-22(12-8-19)45-31(48)24-14-10-21(16-26(24)32(45)49)33(34(36,37)38,35(39,40)41)20-9-13-23-25(15-20)30(47)44(2)29(23)46/h3-16H,1-2H3 |
| InChIKey | JOJQJNSGAFKDJH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.56 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|