C8H4N4O — CID 164813039
8-oxa-3,4,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 164813039) has the molecular formula C8H4N4O and a molecular weight of 172.15 g/mol. Its IUPAC name is 8-oxa-3,4,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 8-oxa-3,4,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 164813039 |
| Molecular Formula | C8H4N4O |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 8-oxa-3,4,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | c1cc2oc3nccnc3c2nn1 |
| InChI | InChI=1S/C8H4N4O/c1-2-11-12-6-5(1)13-8-7(6)9-3-4-10-8/h1-4H |
| InChIKey | AWORLTKXEOZLPE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |