C57H35N5O3 — CID 164813070
5-N,11-N-di(dibenzofuran-3-yl)-5-N,11-N-bis(4-phenylphenyl)-8-oxa-3,6,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-5,11-diamine (PubChem CID 164813070) has the molecular formula C57H35N5O3 and a molecular weight of 837.94 g/mol. Its IUPAC name is 5-N,11-N-di(dibenzofuran-3-yl)-5-N,11-N-bis(4-phenylphenyl)-8-oxa-3,6,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-5,11-diamine.
| Compound Name | 5-N,11-N-di(dibenzofuran-3-yl)-5-N,11-N-bis(4-phenylphenyl)-8-oxa-3,6,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-5,11-diamine |
|---|---|
| PubChem CID | 164813070 |
| Molecular Formula | C57H35N5O3 |
| Molecular Weight | 837.94 g/mol |
| Exact Mass | 837.27 |
| IUPAC Name | 5-N,11-N-di(dibenzofuran-3-yl)-5-N,11-N-bis(4-phenylphenyl)-8-oxa-3,6,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-5,11-diamine |
| SMILES | c1ccc(-c2ccc(N(c3ccc4c(c3)oc3ccccc34)c3ccc4c(n3)oc3nc(N(c5ccc(-c6ccccc6)cc5)c5ccc6c(c5)oc5ccccc56)cnc34)cc2)cc1 |
| InChI | InChI=1S/C57H35N5O3/c1-3-11-36(12-4-1)38-19-23-40(24-20-38)61(42-27-29-46-44-15-7-9-17-49(44)63-51(46)33-42)53-32-31-48-55-57(65-56(48)59-53)60-54(35-58-55)62(41-25-21-39(22-26-41)37-13-5-2-6-14-37)43-28-30-47-45-16-8-10-18-50(45)64-52(47)34-43/h1-35H |
| InChIKey | RDCNQQFBWWWHNG-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 84.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.94 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |