C29H54NO8P — CID 164813591
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-dodec-3-enoyl]oxypropyl] (Z)-dodec-3-enoate (PubChem CID 164813591) has the molecular formula C29H54NO8P and a molecular weight of 575.72 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-dodec-3-enoyl]oxypropyl] (Z)-dodec-3-enoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-dodec-3-enoyl]oxypropyl] (Z)-dodec-3-enoate |
|---|---|
| PubChem CID | 164813591 |
| Molecular Formula | C29H54NO8P |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.36 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-dodec-3-enoyl]oxypropyl] (Z)-dodec-3-enoate |
| SMILES | CCCCCCCC/C=C\CC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)C/C=C\CCCCCCCC |
| InChI | InChI=1S/C29H54NO8P/c1-3-5-7-9-11-13-15-17-19-21-28(31)35-25-27(26-37-39(33,34)36-24-23-30)38-29(32)22-20-18-16-14-12-10-8-6-4-2/h17-20,27H,3-16,21-26,30H2,1-2H3,(H,33,34)/b19-17-,20-18-/t27-/m1/s1 |
| InChIKey | ZTOUGXCMDPFKBL-WBXVBMAFSA-N |
| XLogP | 6.93 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|