About [(Z)-oct-2-enyl] 3-methylbutanoate
[(Z)-oct-2-enyl] 3-methylbutanoate (PubChem CID 164813997) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is [(Z)-oct-2-enyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [(Z)-oct-2-enyl] 3-methylbutanoate |
| PubChem CID | 164813997 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | [(Z)-oct-2-enyl] 3-methylbutanoate |
| SMILES | CCCCC/C=C\COC(=O)CC(C)C |
| InChI | InChI=1S/C13H24O2/c1-4-5-6-7-8-9-10-15-13(14)11-12(2)3/h8-9,12H,4-7,10-11H2,1-3H3/b9-8- |
| InChIKey | XLJLMDVQHSYMKB-HJWRWDBZSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-oct-2-enyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-oct-2-enyl] 3-methylbutanoate?
The IUPAC name of [(Z)-oct-2-enyl] 3-methylbutanoate (CID 164813997) is [(Z)-oct-2-enyl] 3-methylbutanoate.
What is the SMILES notation for [(Z)-oct-2-enyl] 3-methylbutanoate?
The canonical SMILES for [(Z)-oct-2-enyl] 3-methylbutanoate is CCCCC/C=C\COC(=O)CC(C)C.
What is the InChIKey of [(Z)-oct-2-enyl] 3-methylbutanoate?
The InChIKey is XLJLMDVQHSYMKB-HJWRWDBZSA-N. The full InChI is InChI=1S/C13H24O2/c1-4-5-6-7-8-9-10-15-13(14)11-12(2)3/h8-9,12H,4-7,10-11H2,1-3H3/b9-8-.
What are the key properties of [(Z)-oct-2-enyl] 3-methylbutanoate?
[(Z)-oct-2-enyl] 3-methylbutanoate has a molecular weight of 212.33 g/mol, XLogP of 3.71, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-oct-2-enyl] 3-methylbutanoate is sourced from PubChem (CID 164813997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).