C44H81NO — CID 164814071
[1-[[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]methyl]cyclohexyl]methanol (PubChem CID 164814071) has the molecular formula C44H81NO and a molecular weight of 640.14 g/mol. Its IUPAC name is [1-[[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 164814071 |
| Molecular Formula | C44H81NO |
| Molecular Weight | 640.14 g/mol |
| Exact Mass | 639.63 |
| IUPAC Name | [1-[[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]methyl]cyclohexyl]methanol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C/C=C\CCCCC)CC1(CO)CCCCC1 |
| InChI | InChI=1S/C44H81NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-40-45(42-44(43-46)38-34-33-35-39-44)41-37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,46H,3-10,15-16,21-43H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | KSNBKFKDQFOPDF-MAZCIEHSSA-N |
| XLogP | 13.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.14 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|