About CID 164814896
CID 164814896 (PubChem CID 164814896) has the molecular formula C43H52IrNO3-
and a molecular weight of 823.11 g/mol.
Molecular Properties
| Compound Name | CID 164814896 |
| PubChem CID | 164814896 |
| Molecular Formula | C43H52IrNO3- |
| Molecular Weight | 823.11 g/mol |
| Exact Mass | 823.36 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cnc2c3c1oc1c(CC(C)(C)C)ccc(c13)C(C)(C)c1cc3ccccc3[c-]c1-2.[Ir] |
| InChI | InChI=1S/C30H28NO.C13H24O2.Ir/c1-17-16-31-26-21-13-18-9-7-8-10-19(18)14-23(21)30(5,6)22-12-11-20(15-29(2,3)4)28-24(22)25(26)27(17)32-28;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h7-12,14,16H,15H2,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | CSTIAKHGXXOWMX-DZTQYQPZSA-N |
| XLogP | 12.01 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 823.11 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164814896 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164814896?
The IUPAC name of CID 164814896 (CID 164814896) is not available.
What is the SMILES notation for CID 164814896?
The canonical SMILES for CID 164814896 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cnc2c3c1oc1c(CC(C)(C)C)ccc(c13)C(C)(C)c1cc3ccccc3[c-]c1-2.[Ir].
What is the InChIKey of CID 164814896?
The InChIKey is CSTIAKHGXXOWMX-DZTQYQPZSA-N. The full InChI is InChI=1S/C30H28NO.C13H24O2.Ir/c1-17-16-31-26-21-13-18-9-7-8-10-19(18)14-23(21)30(5,6)22-12-11-20(15-29(2,3)4)28-24(22)25(26)27(17)32-28;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h7-12,14,16H,15H2,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 164814896?
CID 164814896 has a molecular weight of 823.11 g/mol, XLogP of 12.01, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164814896 is sourced from PubChem (CID 164814896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).