About CID 164815126
CID 164815126 (PubChem CID 164815126) has the molecular formula C36H40IrNO3Si-
and a molecular weight of 755.02 g/mol.
Molecular Properties
| Compound Name | CID 164815126 |
| PubChem CID | 164815126 |
| Molecular Formula | C36H40IrNO3Si- |
| Molecular Weight | 755.02 g/mol |
| Exact Mass | 755.24 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.C[Si]1(C)c2c(ncc3ccccc23)-c2[c-]ccc3oc4cccc1c4c23.[Ir] |
| InChI | InChI=1S/C23H16NOSi.C13H24O2.Ir/c1-26(2)19-12-6-11-18-21(19)20-16(9-5-10-17(20)25-18)22-23(26)15-8-4-3-7-14(15)13-24-22;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-8,10-13H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | SLILPODXUFLQMZ-DZTQYQPZSA-N |
| XLogP | 8.60 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 755.02 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164815126 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164815126?
The IUPAC name of CID 164815126 (CID 164815126) is not available.
What is the SMILES notation for CID 164815126?
The canonical SMILES for CID 164815126 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.C[Si]1(C)c2c(ncc3ccccc23)-c2[c-]ccc3oc4cccc1c4c23.[Ir].
What is the InChIKey of CID 164815126?
The InChIKey is SLILPODXUFLQMZ-DZTQYQPZSA-N. The full InChI is InChI=1S/C23H16NOSi.C13H24O2.Ir/c1-26(2)19-12-6-11-18-21(19)20-16(9-5-10-17(20)25-18)22-23(26)15-8-4-3-7-14(15)13-24-22;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-8,10-13H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 164815126?
CID 164815126 has a molecular weight of 755.02 g/mol, XLogP of 8.60, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164815126 is sourced from PubChem (CID 164815126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).