C26H30O6Si — CID 164816375
3-[(2,2-diphenyl-4H-1,3-benzodioxin-6-yl)oxy]propyl-trimethoxysilane (PubChem CID 164816375) has the molecular formula C26H30O6Si and a molecular weight of 466.61 g/mol. Its IUPAC name is 3-[(2,2-diphenyl-4H-1,3-benzodioxin-6-yl)oxy]propyl-trimethoxysilane.
| Compound Name | 3-[(2,2-diphenyl-4H-1,3-benzodioxin-6-yl)oxy]propyl-trimethoxysilane |
|---|---|
| PubChem CID | 164816375 |
| Molecular Formula | C26H30O6Si |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 3-[(2,2-diphenyl-4H-1,3-benzodioxin-6-yl)oxy]propyl-trimethoxysilane |
| SMILES | CO[Si](CCCOc1ccc2c(c1)COC(c1ccccc1)(c1ccccc1)O2)(OC)OC |
| InChI | InChI=1S/C26H30O6Si/c1-27-33(28-2,29-3)18-10-17-30-24-15-16-25-21(19-24)20-31-26(32-25,22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-9,11-16,19H,10,17-18,20H2,1-3H3 |
| InChIKey | RUYFOONDXJTPLC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|