C21H24N2O — CID 164817419
2-[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-1-carboxamide (PubChem CID 164817419) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-1-carboxamide.
| Compound Name | 2-[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 164817419 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
| SMILES | NC(=O)c1c(-c2cccc3c2CCC[C@H]3N)ccc2c1CCCC2 |
| InChI | InChI=1S/C21H24N2O/c22-19-10-4-8-15-16(7-3-9-17(15)19)18-12-11-13-5-1-2-6-14(13)20(18)21(23)24/h3,7,9,11-12,19H,1-2,4-6,8,10,22H2,(H2,23,24)/t19-/m1/s1 |
| InChIKey | UUTDAPHWHRMOCD-LJQANCHMSA-N |
| XLogP | 3.67 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |