C14H30N2O2 — CID 164817435
1,4-bis[(2-methylpropan-2-yl)oxymethyl]piperazine (PubChem CID 164817435) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1,4-bis[(2-methylpropan-2-yl)oxymethyl]piperazine.
| Compound Name | 1,4-bis[(2-methylpropan-2-yl)oxymethyl]piperazine |
|---|---|
| PubChem CID | 164817435 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1,4-bis[(2-methylpropan-2-yl)oxymethyl]piperazine |
| SMILES | CC(C)(C)OCN1CCN(COC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H30N2O2/c1-13(2,3)17-11-15-7-9-16(10-8-15)12-18-14(4,5)6/h7-12H2,1-6H3 |
| InChIKey | ULDVSMDOIWYAST-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |