C24H37F3O4SSi2 — CID 164818435
[4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-(trimethylsilylmethyl)-5-trimethylsilyloxyphenyl] trifluoromethanesulfonate (PubChem CID 164818435) has the molecular formula C24H37F3O4SSi2 and a molecular weight of 534.79 g/mol. Its IUPAC name is [4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-(trimethylsilylmethyl)-5-trimethylsilyloxyphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-(trimethylsilylmethyl)-5-trimethylsilyloxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164818435 |
| Molecular Formula | C24H37F3O4SSi2 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | [4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-(trimethylsilylmethyl)-5-trimethylsilyloxyphenyl] trifluoromethanesulfonate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(C[Si](C)(C)C)cc(OS(=O)(=O)C(F)(F)F)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C24H37F3O4SSi2/c1-16(2)20-11-10-17(3)12-21(20)23-18(15-33(4,5)6)13-19(14-22(23)31-34(7,8)9)30-32(28,29)24(25,26)27/h12-14,20-21H,1,10-11,15H2,2-9H3/t20-,21+/m0/s1 |
| InChIKey | YIIQHIHKSMWYKD-LEWJYISDSA-N |
| XLogP | 7.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|