C58H43FN6 — CID 164818895
2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-fluoro-4-spiro[adamantane-2,9'-fluorene]-3'-ylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 164818895) has the molecular formula C58H43FN6 and a molecular weight of 843.02 g/mol. Its IUPAC name is 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-fluoro-4-spiro[adamantane-2,9'-fluorene]-3'-ylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-fluoro-4-spiro[adamantane-2,9'-fluorene]-3'-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164818895 |
| Molecular Formula | C58H43FN6 |
| Molecular Weight | 843.02 g/mol |
| Exact Mass | 842.35 |
| IUPAC Name | 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-fluoro-4-spiro[adamantane-2,9'-fluorene]-3'-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1cc(-c2ccc3c(c2)-c2ccccc2C32C3CC4CC(C3)CC2C4)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C58H43FN6/c59-51-34-45(41-25-26-50-46(32-41)44-23-13-14-24-49(44)58(50)42-28-35-27-36(30-42)31-43(58)29-35)47(56-62-52(37-15-5-1-6-16-37)60-53(63-56)38-17-7-2-8-18-38)33-48(51)57-64-54(39-19-9-3-10-20-39)61-55(65-57)40-21-11-4-12-22-40/h1-26,32-36,42-43H,27-31H2 |
| InChIKey | ODGJFSAVKNDTQN-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.02 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |