C64H50N6 — CID 164819071
2-[5-(6',7'-dimethylspiro[adamantane-2,9'-fluorene]-4'-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 164819071) has the molecular formula C64H50N6 and a molecular weight of 903.15 g/mol. Its IUPAC name is 2-[5-(6',7'-dimethylspiro[adamantane-2,9'-fluorene]-4'-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[5-(6',7'-dimethylspiro[adamantane-2,9'-fluorene]-4'-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164819071 |
| Molecular Formula | C64H50N6 |
| Molecular Weight | 903.15 g/mol |
| Exact Mass | 902.41 |
| IUPAC Name | 2-[5-(6',7'-dimethylspiro[adamantane-2,9'-fluorene]-4'-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cc2c(cc1C)C1(c3cccc(-c4cccc5c(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c45)c3-2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C64H50N6/c1-38-31-53-55(32-39(38)2)64(46-34-40-33-41(36-46)37-47(64)35-40)54-28-16-27-49(57(53)54)48-25-15-26-50-51(62-67-58(42-17-7-3-8-18-42)65-59(68-62)43-19-9-4-10-20-43)29-30-52(56(48)50)63-69-60(44-21-11-5-12-22-44)66-61(70-63)45-23-13-6-14-24-45/h3-32,40-41,46-47H,33-37H2,1-2H3 |
| InChIKey | DEKZAJHIPNXPNT-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.15 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |