C68H49FN6 — CID 164819090
2-[5-[7'-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-fluorophenyl]spiro[adamantane-2,9'-fluorene]-2'-yl]naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 164819090) has the molecular formula C68H49FN6 and a molecular weight of 969.18 g/mol. Its IUPAC name is 2-[5-[7'-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-fluorophenyl]spiro[adamantane-2,9'-fluorene]-2'-yl]naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[5-[7'-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-fluorophenyl]spiro[adamantane-2,9'-fluorene]-2'-yl]naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164819090 |
| Molecular Formula | C68H49FN6 |
| Molecular Weight | 969.18 g/mol |
| Exact Mass | 968.40 |
| IUPAC Name | 2-[5-[7'-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-fluorophenyl]spiro[adamantane-2,9'-fluorene]-2'-yl]naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2ccc3c(c2)C2(c4cc(-c5cccc6c(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)cccc56)ccc4-3)C3CC4CC(C3)CC2C4)c1 |
| InChI | InChI=1S/C68H49FN6/c69-51-29-32-58(67-74-64(45-19-9-3-10-20-45)71-65(75-67)46-21-11-4-12-22-46)59(40-51)48-28-31-56-55-30-27-47(38-60(55)68(61(56)39-48)49-34-41-33-42(36-49)37-50(68)35-41)52-23-13-25-54-53(52)24-14-26-57(54)66-72-62(43-15-5-1-6-16-43)70-63(73-66)44-17-7-2-8-18-44/h1-32,38-42,49-50H,33-37H2 |
| InChIKey | KAOCRCAYAIURNZ-UHFFFAOYSA-N |
| XLogP | 16.41 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.18 |
| LogP ≤ 5 | 16.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |