C22H25ClO — CID 164819418
2-(5-chloro-2-phenylphenyl)-7-methylbicyclo[3.3.1]nonan-2-ol (PubChem CID 164819418) has the molecular formula C22H25ClO and a molecular weight of 340.89 g/mol. Its IUPAC name is 2-(5-chloro-2-phenylphenyl)-7-methylbicyclo[3.3.1]nonan-2-ol.
| Compound Name | 2-(5-chloro-2-phenylphenyl)-7-methylbicyclo[3.3.1]nonan-2-ol |
|---|---|
| PubChem CID | 164819418 |
| Molecular Formula | C22H25ClO |
| Molecular Weight | 340.89 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-(5-chloro-2-phenylphenyl)-7-methylbicyclo[3.3.1]nonan-2-ol |
| SMILES | CC1CC2CCC(O)(c3cc(Cl)ccc3-c3ccccc3)C(C1)C2 |
| InChI | InChI=1S/C22H25ClO/c1-15-11-16-9-10-22(24,18(12-15)13-16)21-14-19(23)7-8-20(21)17-5-3-2-4-6-17/h2-8,14-16,18,24H,9-13H2,1H3 |
| InChIKey | UMUYQQSBFLOEFZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.89 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |