C72H46N4S2 — CID 164819858
2,4-bis(2,3-dimethyl-[1]benzothiolo[2,3-a]carbazol-12-yl)-5-isocyano-3,6-bis(3-phenylphenyl)benzonitrile (PubChem CID 164819858) has the molecular formula C72H46N4S2 and a molecular weight of 1031.32 g/mol. Its IUPAC name is 2,4-bis(2,3-dimethyl-[1]benzothiolo[2,3-a]carbazol-12-yl)-5-isocyano-3,6-bis(3-phenylphenyl)benzonitrile.
| Compound Name | 2,4-bis(2,3-dimethyl-[1]benzothiolo[2,3-a]carbazol-12-yl)-5-isocyano-3,6-bis(3-phenylphenyl)benzonitrile |
|---|---|
| PubChem CID | 164819858 |
| Molecular Formula | C72H46N4S2 |
| Molecular Weight | 1031.32 g/mol |
| Exact Mass | 1030.32 |
| IUPAC Name | 2,4-bis(2,3-dimethyl-[1]benzothiolo[2,3-a]carbazol-12-yl)-5-isocyano-3,6-bis(3-phenylphenyl)benzonitrile |
| SMILES | [C-]#[N+]c1c(-c2cccc(-c3ccccc3)c2)c(C#N)c(-n2c3cc(C)c(C)cc3c3ccc4c5ccccc5sc4c32)c(-c2cccc(-c3ccccc3)c2)c1-n1c2cc(C)c(C)cc2c2ccc3c4ccccc4sc3c21 |
| InChI | InChI=1S/C72H46N4S2/c1-41-34-57-53-30-32-55-51-26-12-14-28-62(51)77-71(55)68(53)75(60(57)36-43(41)3)67-59(40-73)64(49-24-16-22-47(38-49)45-18-8-6-9-19-45)66(74-5)70(65(67)50-25-17-23-48(39-50)46-20-10-7-11-21-46)76-61-37-44(4)42(2)35-58(61)54-31-33-56-52-27-13-15-29-63(52)78-72(56)69(54)76/h6-39H,1-4H3 |
| InChIKey | VWFFJAWZEGRYGR-UHFFFAOYSA-N |
| XLogP | 20.94 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.32 |
| LogP ≤ 5 | 20.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|