C47H32O8 — CID 164819961
(6-formyl-2,2-diphenyl-1,3-benzodioxol-4-yl) 2,2-diphenyl-7-phenylmethoxy-1,3-benzodioxole-5-carboxylate (PubChem CID 164819961) has the molecular formula C47H32O8 and a molecular weight of 724.77 g/mol. Its IUPAC name is (6-formyl-2,2-diphenyl-1,3-benzodioxol-4-yl) 2,2-diphenyl-7-phenylmethoxy-1,3-benzodioxole-5-carboxylate.
| Compound Name | (6-formyl-2,2-diphenyl-1,3-benzodioxol-4-yl) 2,2-diphenyl-7-phenylmethoxy-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 164819961 |
| Molecular Formula | C47H32O8 |
| Molecular Weight | 724.77 g/mol |
| Exact Mass | 724.21 |
| IUPAC Name | (6-formyl-2,2-diphenyl-1,3-benzodioxol-4-yl) 2,2-diphenyl-7-phenylmethoxy-1,3-benzodioxole-5-carboxylate |
| SMILES | O=Cc1cc(OC(=O)c2cc(OCc3ccccc3)c3c(c2)OC(c2ccccc2)(c2ccccc2)O3)c2c(c1)OC(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C47H32O8/c48-30-33-26-40(44-41(27-33)52-46(55-44,35-18-8-2-9-19-35)36-20-10-3-11-21-36)51-45(49)34-28-39(50-31-32-16-6-1-7-17-32)43-42(29-34)53-47(54-43,37-22-12-4-13-23-37)38-24-14-5-15-25-38/h1-30H,31H2 |
| InChIKey | BVXICAGYNXFUDA-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.77 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|