About 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide
2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide (PubChem CID 164820131) has the molecular formula C20H22N4O4S
and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide |
| PubChem CID | 164820131 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide |
| SMILES | COc1cc2ncnc(-c3ccc(C4CCCN4S(N)(=O)=O)cc3)c2cc1OC |
| InChI | InChI=1S/C20H22N4O4S/c1-27-18-10-15-16(11-19(18)28-2)22-12-23-20(15)14-7-5-13(6-8-14)17-4-3-9-24(17)29(21,25)26/h5-8,10-12,17H,3-4,9H2,1-2H3,(H2,21,25,26) |
| InChIKey | ZCVRJKAKYWZGPX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide?
The IUPAC name of 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide (CID 164820131) is 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide.
What is the SMILES notation for 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide?
The canonical SMILES for 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide is COc1cc2ncnc(-c3ccc(C4CCCN4S(N)(=O)=O)cc3)c2cc1OC.
What is the InChIKey of 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide?
The InChIKey is ZCVRJKAKYWZGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O4S/c1-27-18-10-15-16(11-19(18)28-2)22-12-23-20(15)14-7-5-13(6-8-14)17-4-3-9-24(17)29(21,25)26/h5-8,10-12,17H,3-4,9H2,1-2H3,(H2,21,25,26).
What are the key properties of 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide?
2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide has a molecular weight of 414.49 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]pyrrolidine-1-sulfonamide is sourced from PubChem (CID 164820131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).