C26H52O3Sn — CID 164821954
tributyl-[(E,3R,4S)-4-methoxy-4-[(2S,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-3-methylbut-1-enyl]stannane (PubChem CID 164821954) has the molecular formula C26H52O3Sn and a molecular weight of 531.41 g/mol. Its IUPAC name is tributyl-[(E,3R,4S)-4-methoxy-4-[(2S,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-3-methylbut-1-enyl]stannane.
| Compound Name | tributyl-[(E,3R,4S)-4-methoxy-4-[(2S,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-3-methylbut-1-enyl]stannane |
|---|---|
| PubChem CID | 164821954 |
| Molecular Formula | C26H52O3Sn |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | tributyl-[(E,3R,4S)-4-methoxy-4-[(2S,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-3-methylbut-1-enyl]stannane |
| SMILES | CCCC[Sn](/C=C/[C@@H](C)[C@H](OC)[C@H]1O[C@@H]1[C@H](C)[C@H](CC)OC)(CCCC)CCCC |
| InChI | InChI=1S/C14H25O3.3C4H9.Sn/c1-7-9(3)12(16-6)14-13(17-14)10(4)11(8-2)15-5;3*1-3-4-2;/h1,7,9-14H,8H2,2-6H3;3*1,3-4H2,2H3;/t9-,10-,11+,12+,13-,14-;;;;/m1..../s1 |
| InChIKey | GFXMAWCRZZVQJG-CZEVYEOUSA-N |
| XLogP | 7.41 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|