About 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide
3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide (PubChem CID 164822712) has the molecular formula C23H25N5O4S2
and a molecular weight of 499.62 g/mol. Its IUPAC name is 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide.
Molecular Properties
| Compound Name | 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide |
| PubChem CID | 164822712 |
| Molecular Formula | C23H25N5O4S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide |
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2C(=O)NNS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H25N5O4S2/c1-26(2)15-5-11-19-21(13-15)33-22-14-16(27(3)4)6-12-20(22)28(19)23(30)24-25-34(31,32)18-9-7-17(29)8-10-18/h5-14,25,29H,1-4H3,(H,24,30) |
| InChIKey | UHVPBSXGUHIDTE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide?
The IUPAC name of 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide (CID 164822712) is 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide.
What is the SMILES notation for 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide?
The canonical SMILES for 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide is CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2C(=O)NNS(=O)(=O)c1ccc(O)cc1.
What is the InChIKey of 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide?
The InChIKey is UHVPBSXGUHIDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N5O4S2/c1-26(2)15-5-11-19-21(13-15)33-22-14-16(27(3)4)6-12-20(22)28(19)23(30)24-25-34(31,32)18-9-7-17(29)8-10-18/h5-14,25,29H,1-4H3,(H,24,30).
What are the key properties of 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide?
3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide has a molecular weight of 499.62 g/mol, XLogP of 3.73, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-bis(dimethylamino)-N'-(4-hydroxyphenyl)sulfonylphenothiazine-10-carbohydrazide is sourced from PubChem (CID 164822712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).