About tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate
tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate (PubChem CID 164822951) has the molecular formula C14H13NO4S
and a molecular weight of 291.33 g/mol. Its IUPAC name is tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate |
| PubChem CID | 164822951 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(SC#N)Oc2ccccc2C1=O |
| InChI | InChI=1S/C14H13NO4S/c1-13(2,3)19-12(17)14(20-8-15)11(16)9-6-4-5-7-10(9)18-14/h4-7H,1-3H3/t14-/m0/s1 |
| InChIKey | SVFPWHXTFKXCBH-AWEZNQCLSA-N |
| XLogP | 2.51 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate?
The IUPAC name of tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate (CID 164822951) is tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate.
What is the SMILES notation for tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate?
The canonical SMILES for tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate is CC(C)(C)OC(=O)[C@]1(SC#N)Oc2ccccc2C1=O.
What is the InChIKey of tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate?
The InChIKey is SVFPWHXTFKXCBH-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H13NO4S/c1-13(2,3)19-12(17)14(20-8-15)11(16)9-6-4-5-7-10(9)18-14/h4-7H,1-3H3/t14-/m0/s1.
What are the key properties of tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate?
tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate has a molecular weight of 291.33 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-3-oxo-2-thiocyanato-1-benzofuran-2-carboxylate is sourced from PubChem (CID 164822951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).