C22H12FN5O — CID 164825399
6-(7-fluorodibenzofuran-4-yl)-5-phenylimidazo[4,5-d]triazine (PubChem CID 164825399) has the molecular formula C22H12FN5O and a molecular weight of 381.37 g/mol. Its IUPAC name is 6-(7-fluorodibenzofuran-4-yl)-5-phenylimidazo[4,5-d]triazine.
| Compound Name | 6-(7-fluorodibenzofuran-4-yl)-5-phenylimidazo[4,5-d]triazine |
|---|---|
| PubChem CID | 164825399 |
| Molecular Formula | C22H12FN5O |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 6-(7-fluorodibenzofuran-4-yl)-5-phenylimidazo[4,5-d]triazine |
| SMILES | Fc1ccc2c(c1)oc1c(-c3nc4nnncc4n3-c3ccccc3)cccc12 |
| InChI | InChI=1S/C22H12FN5O/c23-13-9-10-15-16-7-4-8-17(20(16)29-19(15)11-13)22-25-21-18(12-24-27-26-21)28(22)14-5-2-1-3-6-14/h1-12H |
| InChIKey | SHCCREGXGQKVMU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |