C29H26N3O+ — CID 164825451
2-dibenzofuran-4-yl-4,6-dimethyl-3-(2,4,6-trimethylphenyl)imidazo[4,5-b]pyridin-4-ium (PubChem CID 164825451) has the molecular formula C29H26N3O+ and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-4,6-dimethyl-3-(2,4,6-trimethylphenyl)imidazo[4,5-b]pyridin-4-ium.
| Compound Name | 2-dibenzofuran-4-yl-4,6-dimethyl-3-(2,4,6-trimethylphenyl)imidazo[4,5-b]pyridin-4-ium |
|---|---|
| PubChem CID | 164825451 |
| Molecular Formula | C29H26N3O+ |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-dibenzofuran-4-yl-4,6-dimethyl-3-(2,4,6-trimethylphenyl)imidazo[4,5-b]pyridin-4-ium |
| SMILES | Cc1cc(C)c(-n2c(-c3cccc4c3oc3ccccc34)nc3cc(C)c[n+](C)c32)c(C)c1 |
| InChI | InChI=1S/C29H26N3O/c1-17-13-19(3)26(20(4)14-17)32-28(30-24-15-18(2)16-31(5)29(24)32)23-11-8-10-22-21-9-6-7-12-25(21)33-27(22)23/h6-16H,1-5H3/q+1 |
| InChIKey | PZBFIOAUZUZRTB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|