C17H24N9O+ — CID 164828645
2-N-[5-[(5-amino-1,2,3,6-tetrahydropyrazin-4-ium-4-yl)methylideneamino]-6-methoxy-3-pyridinyl]-4-N,6-dimethylpyrimidine-2,4-diamine (PubChem CID 164828645) has the molecular formula C17H24N9O+ and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-N-[5-[(5-amino-1,2,3,6-tetrahydropyrazin-4-ium-4-yl)methylideneamino]-6-methoxy-3-pyridinyl]-4-N,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[5-[(5-amino-1,2,3,6-tetrahydropyrazin-4-ium-4-yl)methylideneamino]-6-methoxy-3-pyridinyl]-4-N,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164828645 |
| Molecular Formula | C17H24N9O+ |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-N-[5-[(5-amino-1,2,3,6-tetrahydropyrazin-4-ium-4-yl)methylideneamino]-6-methoxy-3-pyridinyl]-4-N,6-dimethylpyrimidine-2,4-diamine |
| SMILES | CNc1cc(C)nc(Nc2cnc(OC)c(/N=C/[N+]3=C(N)CNCC3)c2)n1 |
| InChI | InChI=1S/C17H23N9O/c1-11-6-15(19-2)25-17(23-11)24-12-7-13(16(27-3)21-8-12)22-10-26-5-4-20-9-14(26)18/h6-8,10,18,20H,4-5,9H2,1-3H3,(H2,19,23,24,25)/p+1/b22-10+ |
| InChIKey | BKCIDMODFSQSKB-LSHDLFTRSA-O |
| XLogP | 0.61 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|