C25H38N6O4Si — CID 164829624
tert-butyl N-[3-[[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate (PubChem CID 164829624) has the molecular formula C25H38N6O4Si and a molecular weight of 514.70 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 164829624 |
| Molecular Formula | C25H38N6O4Si |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | tert-butyl N-[3-[[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate |
| SMILES | Cc1nnc(-c2cnc3c(ccn3COCC[Si](C)(C)C)c2NC2CC(NC(=O)OC(C)(C)C)C2)o1 |
| InChI | InChI=1S/C25H38N6O4Si/c1-16-29-30-23(34-16)20-14-26-22-19(8-9-31(22)15-33-10-11-36(5,6)7)21(20)27-17-12-18(13-17)28-24(32)35-25(2,3)4/h8-9,14,17-18H,10-13,15H2,1-7H3,(H,26,27)(H,28,32) |
| InChIKey | NKNNDEFYNVJWQB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|