C24H36N6O4Si — CID 164829632
tert-butyl N-[3-[[5-(1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate (PubChem CID 164829632) has the molecular formula C24H36N6O4Si and a molecular weight of 500.68 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-(1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-(1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 164829632 |
| Molecular Formula | C24H36N6O4Si |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | tert-butyl N-[3-[[5-(1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(Nc2c(-c3nnco3)cnc3c2ccn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C24H36N6O4Si/c1-24(2,3)34-23(31)28-17-11-16(12-17)27-20-18-7-8-30(15-32-9-10-35(4,5)6)21(18)25-13-19(20)22-29-26-14-33-22/h7-8,13-14,16-17H,9-12,15H2,1-6H3,(H,25,27)(H,28,31) |
| InChIKey | PDOIPCVVFGKPIQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|