C22H20F2N6O — CID 164829650
[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[2-(6-isocyanopyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methanone (PubChem CID 164829650) has the molecular formula C22H20F2N6O and a molecular weight of 422.44 g/mol. Its IUPAC name is [3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[2-(6-isocyanopyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methanone.
| Compound Name | [3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[2-(6-isocyanopyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 164829650 |
| Molecular Formula | C22H20F2N6O |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[2-(6-isocyanopyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methanone |
| SMILES | [C-]#[N+]c1cc(N2CC3CC(C(=O)N4N=CCC4c4cc(F)cc(F)c4)CC3C2)ncn1 |
| InChI | InChI=1S/C22H20F2N6O/c1-25-20-9-21(27-12-26-20)29-10-15-4-14(5-16(15)11-29)22(31)30-19(2-3-28-30)13-6-17(23)8-18(24)7-13/h3,6-9,12,14-16,19H,2,4-5,10-11H2 |
| InChIKey | CLXFMIPTBLPVDN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|