C35H32FN5O5 — CID 164830143
1-[6-[(4-fluoro-2-nitrophenyl)methoxy]-4-(piperidine-1-carbonyl)quinoline-2-carbonyl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 164830143) has the molecular formula C35H32FN5O5 and a molecular weight of 621.67 g/mol. Its IUPAC name is 1-[6-[(4-fluoro-2-nitrophenyl)methoxy]-4-(piperidine-1-carbonyl)quinoline-2-carbonyl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[6-[(4-fluoro-2-nitrophenyl)methoxy]-4-(piperidine-1-carbonyl)quinoline-2-carbonyl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 164830143 |
| Molecular Formula | C35H32FN5O5 |
| Molecular Weight | 621.67 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | 1-[6-[(4-fluoro-2-nitrophenyl)methoxy]-4-(piperidine-1-carbonyl)quinoline-2-carbonyl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CCN(C(=O)c2cc(C(=O)N3CCCCC3)c3cc(OCc4ccc(F)cc4[N+](=O)[O-])ccc3n2)CC1 |
| InChI | InChI=1S/C35H32FN5O5/c36-26-10-9-24(32(19-26)41(44)45)22-46-27-11-12-30-28(20-27)29(33(42)39-15-5-2-6-16-39)21-31(38-30)34(43)40-17-13-35(23-37,14-18-40)25-7-3-1-4-8-25/h1,3-4,7-12,19-21H,2,5-6,13-18,22H2 |
| InChIKey | LSVOTFCPEISMBS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 129.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|