C50H30O — CID 164831036
10-[5-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]naphtho[2,1-b][1]benzofuran (PubChem CID 164831036) has the molecular formula C50H30O and a molecular weight of 654.84 g/mol. Its IUPAC name is 10-[5-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]naphtho[2,1-b][1]benzofuran.
| Compound Name | 10-[5-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]naphtho[2,1-b][1]benzofuran |
|---|---|
| PubChem CID | 164831036 |
| Molecular Formula | C50H30O |
| Molecular Weight | 654.84 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 10-[5-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]naphtho[2,1-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4c(-c5ccc6oc7ccc8ccccc8c7c6c5)cccc34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc4ccccc34)c2c1[2H] |
| InChI | InChI=1S/C50H30O/c1-3-15-34-31(12-1)14-9-24-39(34)48-41-17-5-7-19-43(41)49(44-20-8-6-18-42(44)48)40-25-11-22-37-35(21-10-23-38(37)40)33-27-28-46-45(30-33)50-36-16-4-2-13-32(36)26-29-47(50)51-46/h1-30H/i5D,6D,7D,8D,17D,18D,19D,20D |
| InChIKey | RNSKUNIUTFOXTD-LJHRBXIWSA-N |
| XLogP | 14.35 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.84 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|