C22H36N2O5 — CID 164831400
1-methyl-3-[3-[[(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl]-2H-imidazole (PubChem CID 164831400) has the molecular formula C22H36N2O5 and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-methyl-3-[3-[[(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl]-2H-imidazole.
| Compound Name | 1-methyl-3-[3-[[(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl]-2H-imidazole |
|---|---|
| PubChem CID | 164831400 |
| Molecular Formula | C22H36N2O5 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1-methyl-3-[3-[[(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl]-2H-imidazole |
| SMILES | C[C@H]1[C@@H](OCCCN2C=CN(C)C2)O[C@@H]2OC3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C22H36N2O5/c1-15-6-7-18-16(2)19(25-13-5-10-24-12-11-23(4)14-24)26-20-22(18)17(15)8-9-21(3,27-20)28-29-22/h11-12,15-20H,5-10,13-14H2,1-4H3/t15-,16-,17+,18+,19+,20-,21?,22-/m1/s1 |
| InChIKey | DOYJWFUJRVHAJN-FCYIUIPKSA-N |
| XLogP | 3.28 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|