C25H42N2O4 — CID 164831405
1-methyl-3-[5-[[(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]pentyl]-2H-imidazole (PubChem CID 164831405) has the molecular formula C25H42N2O4 and a molecular weight of 434.62 g/mol. Its IUPAC name is 1-methyl-3-[5-[[(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]pentyl]-2H-imidazole.
| Compound Name | 1-methyl-3-[5-[[(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]pentyl]-2H-imidazole |
|---|---|
| PubChem CID | 164831405 |
| Molecular Formula | C25H42N2O4 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | 1-methyl-3-[5-[[(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]pentyl]-2H-imidazole |
| SMILES | C[C@H]1[C@@H](OCCCCCN2C=CN(C)C2)O[C@@H]2CC3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C25H42N2O4/c1-18-8-9-21-19(2)23(28-15-7-5-6-12-27-14-13-26(4)17-27)29-22-16-24(3)11-10-20(18)25(21,22)31-30-24/h13-14,18-23H,5-12,15-17H2,1-4H3/t18-,19-,20+,21+,22-,23+,24?,25-/m1/s1 |
| InChIKey | SNPLGKWPZDYNRK-FOBOOWJOSA-N |
| XLogP | 4.52 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|