C20H32N2O5 — CID 164831411
1-methyl-3-[[(5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]-2H-imidazole (PubChem CID 164831411) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-methyl-3-[[(5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]-2H-imidazole.
| Compound Name | 1-methyl-3-[[(5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]-2H-imidazole |
|---|---|
| PubChem CID | 164831411 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 1-methyl-3-[[(5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]-2H-imidazole |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](OCN3C=CN(C)C3)O[C@@H]3OC4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C20H32N2O5/c1-13-5-6-16-14(2)17(23-12-22-10-9-21(4)11-22)24-18-20(16)15(13)7-8-19(3,25-18)26-27-20/h9-10,13-18H,5-8,11-12H2,1-4H3/t13-,14-,15?,16?,17+,18-,19?,20-/m1/s1 |
| InChIKey | QEYXAXLMHJPSFU-YRVMARHSSA-N |
| XLogP | 2.84 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|