C50H35N — CID 164831986
N-[2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)naphthalen-1-amine (PubChem CID 164831986) has the molecular formula C50H35N and a molecular weight of 657.89 g/mol. Its IUPAC name is N-[2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)naphthalen-1-amine.
| Compound Name | N-[2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 164831986 |
| Molecular Formula | C50H35N |
| Molecular Weight | 657.89 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | N-[2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-c3cccc4ccccc34)c([2H])c2[2H])c2cccc3ccccc23)c([2H])c([2H])c1-c1ccc(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C50H35N/c1-3-13-37(14-4-1)47-34-29-42(35-49(47)40-15-5-2-6-16-40)36-25-30-43(31-26-36)51(50-24-12-20-39-18-8-10-22-48(39)50)44-32-27-41(28-33-44)46-23-11-19-38-17-7-9-21-45(38)46/h1-35H/i25D,26D,27D,28D,30D,31D,32D,33D |
| InChIKey | RWAGJQGEGOAZED-ZTZIYFLJSA-N |
| XLogP | 14.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.89 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |