C27H27NOSi — CID 164832366
trimethyl-[10-(4-propan-2-yl-2-pyridinyl)naphtho[1,2-b][1]benzofuran-3-yl]silane (PubChem CID 164832366) has the molecular formula C27H27NOSi and a molecular weight of 409.61 g/mol. Its IUPAC name is trimethyl-[10-(4-propan-2-yl-2-pyridinyl)naphtho[1,2-b][1]benzofuran-3-yl]silane.
| Compound Name | trimethyl-[10-(4-propan-2-yl-2-pyridinyl)naphtho[1,2-b][1]benzofuran-3-yl]silane |
|---|---|
| PubChem CID | 164832366 |
| Molecular Formula | C27H27NOSi |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | trimethyl-[10-(4-propan-2-yl-2-pyridinyl)naphtho[1,2-b][1]benzofuran-3-yl]silane |
| SMILES | CC(C)c1ccnc(-c2cccc3c2oc2c4ccc([Si](C)(C)C)cc4ccc32)c1 |
| InChI | InChI=1S/C27H27NOSi/c1-17(2)18-13-14-28-25(16-18)24-8-6-7-22-23-11-9-19-15-20(30(3,4)5)10-12-21(19)26(23)29-27(22)24/h6-17H,1-5H3 |
| InChIKey | JRXCGZJSNYIOKM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|