C13H23NO2 — CID 164833370
(1S,2R,3'R,4R,4'R)-3',4'-dimethoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-amine (PubChem CID 164833370) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (1S,2R,3'R,4R,4'R)-3',4'-dimethoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-amine.
| Compound Name | (1S,2R,3'R,4R,4'R)-3',4'-dimethoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-amine |
|---|---|
| PubChem CID | 164833370 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (1S,2R,3'R,4R,4'R)-3',4'-dimethoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-amine |
| SMILES | CO[C@@H]1CC2(C[C@H]1OC)[C@@H]1CC[C@@H](C1)[C@H]2N |
| InChI | InChI=1S/C13H23NO2/c1-15-10-6-13(7-11(10)16-2)9-4-3-8(5-9)12(13)14/h8-12H,3-7,14H2,1-2H3/t8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | XCDQNIGUHOIROJ-VSSNEEPJSA-N |
| XLogP | 1.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |