C16H21NO — CID 164833395
(NZ)-N-[(1R,3S,4S)-3-benzyl-3-ethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 164833395) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (NZ)-N-[(1R,3S,4S)-3-benzyl-3-ethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1R,3S,4S)-3-benzyl-3-ethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 164833395 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (NZ)-N-[(1R,3S,4S)-3-benzyl-3-ethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | CC[C@@]1(Cc2ccccc2)/C(=N\O)[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H21NO/c1-2-16(11-12-6-4-3-5-7-12)14-9-8-13(10-14)15(16)17-18/h3-7,13-14,18H,2,8-11H2,1H3/b17-15-/t13-,14+,16+/m1/s1 |
| InChIKey | IUJWNKJNNJGAIY-SWJWOYBASA-N |
| XLogP | 3.89 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|