C12H21NO2 — CID 164833413
(1S,1'S,2S,2'S,3S,4R)-3-amino-2'-methoxyspiro[bicyclo[2.2.1]heptane-2,4'-cyclopentane]-1'-ol (PubChem CID 164833413) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (1S,1'S,2S,2'S,3S,4R)-3-amino-2'-methoxyspiro[bicyclo[2.2.1]heptane-2,4'-cyclopentane]-1'-ol.
| Compound Name | (1S,1'S,2S,2'S,3S,4R)-3-amino-2'-methoxyspiro[bicyclo[2.2.1]heptane-2,4'-cyclopentane]-1'-ol |
|---|---|
| PubChem CID | 164833413 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (1S,1'S,2S,2'S,3S,4R)-3-amino-2'-methoxyspiro[bicyclo[2.2.1]heptane-2,4'-cyclopentane]-1'-ol |
| SMILES | CO[C@H]1C[C@@]2(C[C@@H]1O)[C@H]1CC[C@H](C1)[C@@H]2N |
| InChI | InChI=1S/C12H21NO2/c1-15-10-6-12(5-9(10)14)8-3-2-7(4-8)11(12)13/h7-11,14H,2-6,13H2,1H3/t7-,8+,9+,10+,11+,12+/m1/s1 |
| InChIKey | CJIIKUIYJNKQQP-VXXUGFECSA-N |
| XLogP | 0.90 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |